ChemNet > CAS > 78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
상품명칭 |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
영문 이름 |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile;2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
분자식 |
C13H7ClN2O2S |
분자량 |
290.7249 |
InChI |
InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
cas번호 |
78940-73-5 |
분자 구조 |
|
밀도 |
1.47g/cm3 |
녹는 점 |
167℃ |
비등점 |
452.8°C at 760 mmHg |
굴절 지수 |
1.685 |
인화점 |
227.6°C |
증기압 |
2.18E-08mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|